Malvin

,7-dihydroxy-3,5-dimethoxyflavylium | SystematicName = 7-Hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-3,5-bis{[(2''S'',3''R'',4''S'',5''S'',6''R'')-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-1λ4-benzopyran-1-ylium | OtherNames = Malvidin 3,5-diglucoside |Section1= | CASNo = 16727-30-3 | UNII_Ref = | UNII = I9I120531L | PubChem = 441765 | ChEBI_Ref = | ChEBI = 75030 | KEGG_Ref = | KEGG = C08718 | ChemSpiderID_Ref = | ChemSpiderID = 390365 | ChemSpiderID_Comment = (cation) | ChemSpiderID1_Ref = | ChemSpiderID1 = 16498815 | ChemSpiderID1_Comment = (chloride) | SMILES = COC1=CC(=CC(=C1O)OC)C2=C(C=C3C(=CC(=CC3=[O+]2)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O | SMILES_Comment = (cation) | SMILES1 = [Cl-].O[C@@H]5[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]5Oc2cc(O)cc3[o+]c(c(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)cc23)c4cc(OC)c(O)c(OC)c4 | SMILES1_Comment = (chloride) | InChI = 1S/C29H34O17/c1-40-15-3-10(4-16(41-2)20(15)33)27-17(44-29-26(39)24(37)22(35)19(9-31)46-29)7-12-13(42-27)5-11(32)6-14(12)43-28-25(38)23(36)21(34)18(8-30)45-28/h3-7,18-19,21-26,28-31,34-39H,8-9H2,1-2H3,(H-,32,33)/p+1/t18-,19-,21-,22-,23+,24+,25-,26-,28-,29-/m1/s1 | InChI_Comment = (cation) | InChIKey = CILLXFBAACIQNS-BTXJZROQSA-O | InChI1 = 1S/C29H34O17.ClH/c1-40-15-3-10(4-16(41-2)20(15)33)27-17(44-29-26(39)24(37)22(35)19(9-31)46-29)7-12-13(42-27)5-11(32)6-14(12)43-28-25(38)23(36)21(34)18(8-30)45-28;/h3-7,18-19,21-26,28-31,34-39H,8-9H2,1-2H3,(H-,32,33);1H/t18-,19-,21-,22-,23+,24+,25-,26-,28-,29-;/m1./s1 | InChI1_Comment = (chloride) | InChIKey1 = RHKJIVJBQJXLBY-FTIBDFQESA-N }} |Section2= | MolarMass = | Appearance = Reddish blue, odorless powder | Density = | MeltingPt= | BoilingPt= | Solubility= Nearly insoluble }} |Section3= }} Malvin is a naturally occurring chemical of the anthocyanin family.

Malvin reacts in the presence of H2O2 to form malvone. The ortho-benzoyloxyphenylacetic acid esters reaction product is dependant of the pH: it is obtained under acidic conditions whereas under neutral conditions, the reaction product is the 3-O-acyl-glucosyl-5-O-glucosyl-7-hydroxy coumarin. Provided by Wikipedia
Showing 1 - 20 results of 54 for search 'Malvin', query time: 0.14s Refine Results
  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  6. 6
  7. 7
  8. 8
  9. 9
  10. 10
  11. 11
  12. 12
  13. 13
  14. 14
  15. 15
  16. 16
  17. 17
  18. 18
  19. 19
  20. 20