Crystal structure of aqua(2,2′-bipyridine-N,N′)bis(3-hydroxy-transcinnamato- O,O′)cadmium(II), Cd(H2O)(C10H8N2)(C9H7O3)2
C28H24CdN2O7, monoclinic, P121/c1 (no. 14), a = 8.6880(8) Å, b = 18.893(2) Å, c = 15.585(1) Å, β = 99.199(2)°, V = 2525.3 Å3, Z = 4, Rgt(F) = 0.113, wRref(F2) = 0.194, T = 298 K.
| Main Authors: | , , |
|---|---|
| Format: | Article |
| Language: | English |
| Published: |
De Gruyter
2005-09-01
|
| Series: | Zeitschrift für Kristallographie - New Crystal Structures |
| Online Access: | https://doi.org/10.1524/ncrs.2005.220.3.390 |
| id |
doaj-eb8a6b7b829a4aeea24c6ad84e902081 |
|---|---|
| record_format |
Article |
| spelling |
doaj-eb8a6b7b829a4aeea24c6ad84e9020812021-09-06T19:21:38ZengDe GruyterZeitschrift für Kristallographie - New Crystal Structures1433-72662197-45782005-09-01220339039210.1524/ncrs.2005.220.3.390Crystal structure of aqua(2,2′-bipyridine-N,N′)bis(3-hydroxy-transcinnamato- O,O′)cadmium(II), Cd(H2O)(C10H8N2)(C9H7O3)2Cheng Y.-Q.0Cai X.-Q.1Hu M.-L.2Wenzhou Normal College, Department of Chemistry and Materials Science, Wenzhou, 325027 P. R. ChinaWenzhou Normal College, Department of Chemistry and Materials Science, Wenzhou, 325027 P. R. ChinaWenzhou Normal College, Department of Chemistry and Materials Science, Wenzhou, 325027 P. R. ChinaC28H24CdN2O7, monoclinic, P121/c1 (no. 14), a = 8.6880(8) Å, b = 18.893(2) Å, c = 15.585(1) Å, β = 99.199(2)°, V = 2525.3 Å3, Z = 4, Rgt(F) = 0.113, wRref(F2) = 0.194, T = 298 K.https://doi.org/10.1524/ncrs.2005.220.3.390 |
| collection |
DOAJ |
| language |
English |
| format |
Article |
| sources |
DOAJ |
| author |
Cheng Y.-Q. Cai X.-Q. Hu M.-L. |
| spellingShingle |
Cheng Y.-Q. Cai X.-Q. Hu M.-L. Crystal structure of aqua(2,2′-bipyridine-N,N′)bis(3-hydroxy-transcinnamato- O,O′)cadmium(II), Cd(H2O)(C10H8N2)(C9H7O3)2 Zeitschrift für Kristallographie - New Crystal Structures |
| author_facet |
Cheng Y.-Q. Cai X.-Q. Hu M.-L. |
| author_sort |
Cheng Y.-Q. |
| title |
Crystal structure of aqua(2,2′-bipyridine-N,N′)bis(3-hydroxy-transcinnamato- O,O′)cadmium(II), Cd(H2O)(C10H8N2)(C9H7O3)2 |
| title_short |
Crystal structure of aqua(2,2′-bipyridine-N,N′)bis(3-hydroxy-transcinnamato- O,O′)cadmium(II), Cd(H2O)(C10H8N2)(C9H7O3)2 |
| title_full |
Crystal structure of aqua(2,2′-bipyridine-N,N′)bis(3-hydroxy-transcinnamato- O,O′)cadmium(II), Cd(H2O)(C10H8N2)(C9H7O3)2 |
| title_fullStr |
Crystal structure of aqua(2,2′-bipyridine-N,N′)bis(3-hydroxy-transcinnamato- O,O′)cadmium(II), Cd(H2O)(C10H8N2)(C9H7O3)2 |
| title_full_unstemmed |
Crystal structure of aqua(2,2′-bipyridine-N,N′)bis(3-hydroxy-transcinnamato- O,O′)cadmium(II), Cd(H2O)(C10H8N2)(C9H7O3)2 |
| title_sort |
crystal structure of aqua(2,2′-bipyridine-n,n′)bis(3-hydroxy-transcinnamato- o,o′)cadmium(ii), cd(h2o)(c10h8n2)(c9h7o3)2 |
| publisher |
De Gruyter |
| series |
Zeitschrift für Kristallographie - New Crystal Structures |
| issn |
1433-7266 2197-4578 |
| publishDate |
2005-09-01 |
| description |
C28H24CdN2O7, monoclinic, P121/c1 (no. 14), a = 8.6880(8) Å, b = 18.893(2) Å, c = 15.585(1) Å, β = 99.199(2)°, V = 2525.3 Å3, Z = 4, Rgt(F) = 0.113, wRref(F2) = 0.194, T = 298 K. |
| url |
https://doi.org/10.1524/ncrs.2005.220.3.390 |
| work_keys_str_mv |
AT chengyq crystalstructureofaqua22bipyridinennbis3hydroxytranscinnamatooocadmiumiicdh2oc10h8n2c9h7o32 AT caixq crystalstructureofaqua22bipyridinennbis3hydroxytranscinnamatooocadmiumiicdh2oc10h8n2c9h7o32 AT huml crystalstructureofaqua22bipyridinennbis3hydroxytranscinnamatooocadmiumiicdh2oc10h8n2c9h7o32 |
| _version_ |
1717773838870118400 |