Crystal structure of poly[diaqua-4-carboxylatephenylacetate-κ2O,O'-1,2- di-(4-pyridyl-κN)-ethane-nickel(II) 0.33 hydrate, Ni(C9H6O4)(C12H10N2)(H2O)2·(H2O)0.33, C21H20.66N2NiO6.33
C21H20.66N2NiO6.33, triclinic, P1̅ (no. 2), a = 8.8119(9) Å, b = 11.367(1) Å, c = 11.689(2) Å, α = 108.992(2)°, β = 98.580(2)°, γ = 108.045(1)°, V = 1011.2 Å3, Z = 2, Rgt(F) = 0.0329, wRref(F2) = 0.0935, T = 296 K.
Main Authors: | , |
---|---|
Format: | Article |
Language: | English |
Published: |
De Gruyter
2013-06-01
|
Series: | Zeitschrift für Kristallographie - New Crystal Structures |
Online Access: | https://doi.org/10.1524/ncrs.2013.0093 |
id |
doaj-bfa50300754641b39645bf9575a691c1 |
---|---|
record_format |
Article |
spelling |
doaj-bfa50300754641b39645bf9575a691c12021-09-06T19:21:56ZengDe GruyterZeitschrift für Kristallographie - New Crystal Structures1433-72662197-45782013-06-01228219519610.1524/ncrs.2013.0093Crystal structure of poly[diaqua-4-carboxylatephenylacetate-κ2O,O'-1,2- di-(4-pyridyl-κN)-ethane-nickel(II) 0.33 hydrate, Ni(C9H6O4)(C12H10N2)(H2O)2·(H2O)0.33, C21H20.66N2NiO6.33Li Gui-Lian0Yin Wen-Dong1College of Chemistry and Chemical Engineering, LuoYang Normal University, Luoyang 471022, Henan Province, P. R. ChinaCollege of Chemistry and Chemical Engineering, LuoYang Normal University, Luoyang 471022, Henan Province, P. R. ChinaC21H20.66N2NiO6.33, triclinic, P1̅ (no. 2), a = 8.8119(9) Å, b = 11.367(1) Å, c = 11.689(2) Å, α = 108.992(2)°, β = 98.580(2)°, γ = 108.045(1)°, V = 1011.2 Å3, Z = 2, Rgt(F) = 0.0329, wRref(F2) = 0.0935, T = 296 K.https://doi.org/10.1524/ncrs.2013.0093 |
collection |
DOAJ |
language |
English |
format |
Article |
sources |
DOAJ |
author |
Li Gui-Lian Yin Wen-Dong |
spellingShingle |
Li Gui-Lian Yin Wen-Dong Crystal structure of poly[diaqua-4-carboxylatephenylacetate-κ2O,O'-1,2- di-(4-pyridyl-κN)-ethane-nickel(II) 0.33 hydrate, Ni(C9H6O4)(C12H10N2)(H2O)2·(H2O)0.33, C21H20.66N2NiO6.33 Zeitschrift für Kristallographie - New Crystal Structures |
author_facet |
Li Gui-Lian Yin Wen-Dong |
author_sort |
Li Gui-Lian |
title |
Crystal structure of poly[diaqua-4-carboxylatephenylacetate-κ2O,O'-1,2- di-(4-pyridyl-κN)-ethane-nickel(II) 0.33 hydrate, Ni(C9H6O4)(C12H10N2)(H2O)2·(H2O)0.33, C21H20.66N2NiO6.33 |
title_short |
Crystal structure of poly[diaqua-4-carboxylatephenylacetate-κ2O,O'-1,2- di-(4-pyridyl-κN)-ethane-nickel(II) 0.33 hydrate, Ni(C9H6O4)(C12H10N2)(H2O)2·(H2O)0.33, C21H20.66N2NiO6.33 |
title_full |
Crystal structure of poly[diaqua-4-carboxylatephenylacetate-κ2O,O'-1,2- di-(4-pyridyl-κN)-ethane-nickel(II) 0.33 hydrate, Ni(C9H6O4)(C12H10N2)(H2O)2·(H2O)0.33, C21H20.66N2NiO6.33 |
title_fullStr |
Crystal structure of poly[diaqua-4-carboxylatephenylacetate-κ2O,O'-1,2- di-(4-pyridyl-κN)-ethane-nickel(II) 0.33 hydrate, Ni(C9H6O4)(C12H10N2)(H2O)2·(H2O)0.33, C21H20.66N2NiO6.33 |
title_full_unstemmed |
Crystal structure of poly[diaqua-4-carboxylatephenylacetate-κ2O,O'-1,2- di-(4-pyridyl-κN)-ethane-nickel(II) 0.33 hydrate, Ni(C9H6O4)(C12H10N2)(H2O)2·(H2O)0.33, C21H20.66N2NiO6.33 |
title_sort |
crystal structure of poly[diaqua-4-carboxylatephenylacetate-κ2o,o'-1,2- di-(4-pyridyl-κn)-ethane-nickel(ii) 0.33 hydrate, ni(c9h6o4)(c12h10n2)(h2o)2·(h2o)0.33, c21h20.66n2nio6.33 |
publisher |
De Gruyter |
series |
Zeitschrift für Kristallographie - New Crystal Structures |
issn |
1433-7266 2197-4578 |
publishDate |
2013-06-01 |
description |
C21H20.66N2NiO6.33, triclinic, P1̅ (no. 2), a = 8.8119(9) Å, b = 11.367(1) Å, c = 11.689(2) Å, α = 108.992(2)°, β = 98.580(2)°, γ = 108.045(1)°, V = 1011.2 Å3, Z = 2, Rgt(F) = 0.0329, wRref(F2) = 0.0935, T = 296 K. |
url |
https://doi.org/10.1524/ncrs.2013.0093 |
work_keys_str_mv |
AT liguilian crystalstructureofpolydiaqua4carboxylatephenylacetatek2oo12di4pyridylknethanenickelii033hydratenic9h6o4c12h10n2h2o2h2o033c21h2066n2nio633 AT yinwendong crystalstructureofpolydiaqua4carboxylatephenylacetatek2oo12di4pyridylknethanenickelii033hydratenic9h6o4c12h10n2h2o2h2o033c21h2066n2nio633 |
_version_ |
1717773060630642688 |