Crystal structure of nitrato-O,O -bis(1,10-phenanthroline)nitritolead(II), Pb(phen)2(NO3)1.5(NO2)0.5

Crystal structure of nitrato-O,O -bis(1,10-phenanthroline)nitritolead(II), Pb(phen)2(NO3)1.5(NO2)0.5

Show other versions (1)

C24H16N6O5.50Pb, triclinic, P1 (No. 2), a = 7.805(2) Å, b = 11.332(2) Å, c = 13.184(3) Å, α = 94.934(3)0, β = 99.471(3)0, γ = 101.504(3)0, V = 1118.6 Å3, Z = 2, Rgt(F) = 0.028, wRref(F2) = 0.066, T = 110 K.

Bibliographic Details
Main Authors: Morsali A., Mahjoub A. R., Bijanzadeh H. R.
Format: Article
Language:English
Published: De Gruyter 2003-06-01
Series:Zeitschrift für Kristallographie - New Crystal Structures
Online Access:https://doi.org/10.1524/ncrs.2003.218.2.189
Description
Summary:C24H16N6O5.50Pb, triclinic, P1 (No. 2), a = 7.805(2) Å, b = 11.332(2) Å, c = 13.184(3) Å, α = 94.934(3)0, β = 99.471(3)0, γ = 101.504(3)0, V = 1118.6 Å3, Z = 2, Rgt(F) = 0.028, wRref(F2) = 0.066, T = 110 K.
ISSN:1433-7266
2197-4578

Similar Items